|
Interfacial spin transmission and spin–orbit torques in as-grown and annealed W/Co2FeAl/MgO multilayers 2020-10-30 |
|
0.63 |
|
Promising valleytronic materials with strong spin-valley coupling in two-dimensional MN2X2 (M = Mo, W; X = F, H) 2020-10-30 |
|
1 |
|
Dynamics of skyrmion bags driven by the spin–orbit torque 2020-10-29 |
|
1 |
|
Geometric metasurface for multiplexing terahertz plasmonic vortices 2020-10-29 |
|
0.80 |
|
Photonic molecules stacked on multicore optical fiber for vapor sensing 2020-10-29 |
|
1 |
|
An ultralow frequency, low intensity, and multidirectional piezoelectric vibration energy harvester using liquid as energy-capturing medium 2020-10-28 |
|
1 |
|
Application of self-healing property of partially coherent beams to ghost imaging 2020-10-28 |
|
0.80 |
|
Time-dependent resistance of quasi-two-dimensional electron gas on KTaO3 2020-10-28 |
|
1 |
|
Adjustable charge states of nitrogen-vacancy centers in low-nitrogen diamond after electron irradiation and subsequent annealing 2020-10-27 |
|
1 |
|
Bi-functional meta-device with full energy utilization in co- and cross-polarization fields 2020-10-27 |
|
0.71 |
|
Interfacial optimization of quantum dot and silica hybrid nanocomposite for simultaneous enhancement of fluorescence retention and stability 2020-10-27 |
|
1 |
|
Physical implementation of dolphin biosonar to facilitate ultrasound control 2020-10-27 |
|
0.87 |
|
Anisotropic avalanche dynamics during ferroelectric switching in BaTiO3 and 0.7Pb(Mg2/3Nb1/3)O3–0.3PbTiO3 2020-10-26 |
|
0.92 |
|
Influence of disorder on superconductivity in the Si(111)-√7×√3-In surface 2020-10-26 |
|
1 |
|
Platinum composition dependence of spin-orbit torque in (Fe0.8Mn0.2)1−xPtx single-layer ferromagnet 2020-10-26 |
|
0.05 |
|
Amplitude-modulated resonant accelerometer employing parametric pump 2020-10-21 |
|
0.17 |
|
Atomic observation of phase transition in layered SnS2 driven by in situ heating and electron beam irradiation 2020-10-21 |
|
1 |
|
Self-driven photodetector based on a GaSe/MoSe2 selenide van der Waals heterojunction with the hybrid contact 2020-10-21 |
|
1 |
|
A stacked electromagnetic energy harvester with frequency up-conversion for swing motion 2020-10-20 |
|
0.75 |
|
Cubic silicon carbide/zinc oxide heterostructure fuel cells 2020-10-20 |
|
0.75 |
|
Molecular beam epitaxy growth and strain-induced bandgap of monolayer 1T′-WTe2 on SrTiO3(001) 2020-10-20 |
|
1 |
|
Opto-fluidic-plasmonic liquid-metal core microcavity 2020-10-20 |
|
1 |
|
Prussian blue analog Co3[Co(CN)6]2 as a cathode material for lithium–sulfur batteries 2020-10-20 |
|
0.88 |
|
Rotated angular modulated electronic and optical properties of bilayer phosphorene: A first-principles study 2020-10-20 |
|
1 |
|
Thermally assisted charge transfer and charge separation in organic donor–acceptor solar cells 2020-10-20 |
|
0.80 |
|
ALD-grown oxide protective layers on Ta3N5–Cu2O n–p nanoarray heterojunction for improved photoelectrochemical water splitting 2020-10-19 |
|
1 |
|
Low-temperature fabrication of carbon-electrode based, hole-conductor-free and mesoscopic perovskite solar cells with power conversion efficiency > 12% and storage-stability > 220 days 2020-10-19 |
|
0.94 |
|
Magnetic-field control of near-field radiative heat transfer between graphene-based hyperbolic metamaterials 2020-10-19 |
|
1 |
|
Modeling and optimization of radiative cooling based thermoelectric generators 2020-10-19 |
|
0.50 |
|
Multiferroic thin film via SrRuO3–BaTiO3 vertically aligned nanocomposite design 2020-10-19 |
|
1 |
|
Natural granular pile as electromagnetic ground cloak 2020-10-19 |
|
0.33 |
|
Vortex-induced swing (VIS) motion for energy harvesters and flowmeters 2020-10-16 |
|
1 |
|
Giant enhancing photoresponse at LaAlO3/SrTiO3 interfaces by the nickelate buffer layer 2020-10-15 |
|
1 |
|
Acoustic impedance regulation of Helmholtz resonators for perfect sound absorption via roughened embedded necks 2020-10-14 |
|
1 |
|
Amplifying photocurrent of graphene on GeSn film by sandwiching a thin oxide between them 2020-10-14 |
|
0.30 |
|
C–N-codoped Sb2Te3 chalcogenides for reducing writing current of phase-change devices 2020-10-13 |
|
0.63 |
|
High performance planar microcavity organic semiconductor lasers based on thermally evaporated top distributed Bragg reflector 2020-10-13 |
|
0.33 |
|
Measurement of angstrom-level laser induced protrusion using touchdown in heat-assisted magnetic recording 2020-10-13 |
|
0.25 |
|
Realization of multidimensional sound propagation in 3D acoustic higher-order topological insulator 2020-10-13 |
|
0.23 |
|
Stacking the MoS2/GeSe2 vertical van der Waals heterostructure for memory device 2020-10-13 |
|
1 |
|
Observation of split defect-bound excitons in twisted WSe2/WSe2 homostructure 2020-10-12 |
|
0.91 |
|
Quadruple perovskite oxide LaCu3Co2Re2O12: A ferrimagnetic half metal with nearly 100% B-site degree of order 2020-10-12 |
|
0.41 |
|
Strain-induced hierarchical ripples in MoS2 layers investigated by atomic force microscopy 2020-10-12 |
|
0.88 |
|
Thickness-dependent electronic transport induced by in situ transformation of point defects in MBE-grown Bi2Te3 thin films 2020-10-12 |
|
0.82 |
|
Double core shell structured Al@Al2O3@SiO2 filled epoxy composites for thermal management application 2020-10-08 |
|
1 |
|
Tri-gate GaN junction HEMT 2020-10-07 |
|
0.10 |
|
Field free magnetization switching in perpendicularly magnetized Pt/Co/FeNi/Ta structure by spin orbit torque 2020-10-06 |
|
1 |
|
Improved output performance of triboelectric nanogenerators based on polydimethylsiloxane composites by the capacitive effect of embedded carbon nanotubes 2020-10-06 |
|
1 |
|
Monolayer 1T-LaN2: Dirac spin-gapless semiconductor of p-state and Chern insulator with a high Chern number 2020-10-06 |
|
0.33 |
|
Dynamics and concentration variations of fine particles of different sizes in the vicinity of DC conductors 2020-10-05 |
|
0.80 |
|
Reduced screening of remote phonon scattering in thin-film transistors caused by gate-electrode/gate-dielectric interlayer 2020-10-05 |
|
1 |
|
Relaxation of competing electromechanical couplings in murine artery 2020-10-05 |
|
0.96 |
|
Temperature-dependent phase noise properties of a two-section GaSb-based mode-locked laser emitting at 2 μm 2020-10-05 |
|
0.40 |
|
Polarization-induced anisotropic damping in Co/[Pb (Mg1/3Nb2/3)O3]0.7–[PbTiO3]0.3 (011) heterostructure 2020-10-02 |
|
1 |
|
Efficient organic solar cells with the active layer fabricated from glovebox to ambient condition 2020-10-01 |
|
1 |
|
A facile strategy to produce monatomic tantalum metallic glass 2020-09-30 |
|
1 |
|
Measurements of spin–orbit interaction in epitaxially grown InAs nanosheets 2020-09-30 |
|
1 |
|
Oxygen annealing impact on β-Ga2O3 MOSFETs: Improved pinch-off characteristic and output power density 2020-09-30 |
|
1 |
|
A half-metallic ferrimagnet of CeCu3Cr4O12 with 4f itinerant electron 2020-09-29 |
|
1 |
|
Cathodoluminescence nano-characterization of individual GaN/AlN quantum disks embedded in nanowires 2020-09-29 |
|
0.52 |
|
Electrostatic-doping-controlled phase separation in electron-doped manganites 2020-09-29 |
|
1 |
|
Feedthrough parasitic nonlinear resonance in micromechanical oscillators 2020-09-29 |
|
0.29 |
|
High frequency lithium niobate film-thickness-mode optomechanical resonator 2020-09-29 |
|
0.17 |
|
Size-derived reaction mechanism of core-shell aluminum nanoparticle 2020-09-29 |
|
0.83 |
|
Bending strain tailored exchange bias in epitaxial NiMn/γ′-Fe4N bilayers 2020-09-28 |
|
0.50 |
|
Generation of a large-scale uniform plasma plume through the interactions between a pair of atmospheric pressure argon plasma jets 2020-09-28 |
|
1 |
|
High-speed ultraviolet photodetectors based on 2D layered CuInP2S6 nanoflakes 2020-09-28 |
|
1 |
|
Near-infrared free carrier absorption enhancement of heavily doped silicon in all-dielectric metasurface 2020-09-28 |
|
1 |
|
Negative constant voltage stress-induced threshold voltage instability in hydrogen-terminated diamond MOSFETs with low-temperature deposited Al2O3 2020-09-28 |
|
1 |
|
Orbital-fluctuation freezing and magnetic-nonmagnetic phase transition in α-TiBr3 2020-09-28 |
|
1 |
|
Phase change interface stability during isochoric solidification of an aqueous solution 2020-09-28 |
|
0.38 |
|
Spatially resolving heterogeneous thermal conductivity of BiCuSeO based thermoelectric nanostructures via scanning thermal microscopy 2020-09-28 |
|
1 |
|
Spin-reorientation transition induced magnetic skyrmion in Nd2Fe14B magnet 2020-09-28 |
|
0.89 |
|
Temporal acoustic wave computational metamaterials 2020-09-28 |
|
1 |
|
Unified theoretical model for both one- and two-color laser excitation of terahertz waves from a liquid 2020-09-28 |
|
1 |
|
Crossover from normal to relaxor ferroelectric in Sr0.25Ba0.75(Nb1−xTax)2O6 ceramics with tungsten bronze structure 2020-09-24 |
|
1 |
|
Enhancing sensitivity of lateral flow assay with application to SARS-CoV-2 2020-09-24 |
|
0.14 |
|
Low-pass filtering compensation in common-path digital holographic microscopy 2020-09-24 |
|
0.13 |
|
Magnon-mediated spin currents in Tm3Fe5O12/Pt with perpendicular magnetic anisotropy 2020-09-24 |
|
0.20 |
|
Strong spin-lattice coupling in tetragonal-like BiFeO3 films with thermal expansion anomalies 2020-09-24 |
|
1 |
|
Anomalous thermoacoustic effect in topological insulator for sound applications 2020-09-23 |
|
1 |
|
Analysis of the Griffiths–like phase observed in binary ε-Fe2N nitride 2020-09-22 |
|
0.90 |
|
Experimental synthesis of random light sources with circular coherence by digital micro-mirror device 2020-09-22 |
|
0.83 |
|
Frequency doubler based on a single MoTe2/MoS2 anti-ambipolar heterostructure 2020-09-22 |
|
1 |
|
Static and dynamic origins of interfacial anomalous Hall effect in W/YIG heterostructures 2020-09-22 |
|
0.88 |
|
Efficient quantum theory for studying cold charge-transfer state dissociations in donor–acceptor heterojunction organic solar cells 2020-09-21 |
|
1 |
|
Highly sensitive heat flux sensor based on the transverse thermoelectric effect of YBa2Cu3O7−δ thin film 2020-09-21 |
|
0.83 |
|
Phonon-limited electronic transport of two-dimensional ultrawide bandgap material h-BeO 2020-09-21 |
|
1 |
|
Reduction of hysteresis loss in soft magnetic composites under transverse magnetic field 2020-09-21 |
|
1 |
|
Robust spin–orbit torques in ferromagnetic multilayers with weak bulk spin Hall effect 2020-09-21 |
|
0.93 |
|
Toward ultrathin ferromagnetic metal of (110) La2/3Sr1/3MnO3 thin films 2020-09-21 |
|
0.50 |
|
Dual functionalized Janus structural PVDF nanocomposite with surface-modified dielectric and magnetic nanoparticles 2020-09-18 |
|
1 |
|
High energy density and high efficiency achieved in the Ca0.74Sr0.26Zr0.7Ti0.3O3 linear dielectric thin films on the silicon substrates 2020-09-18 |
|
1 |
|
Investigation of carrier compensation traps in n−-GaN drift layer by high-temperature deep-level transient spectroscopy 2020-09-18 |
|
1 |
|
Local initial heteroepitaxial growth of diamond (111) on Ru (0001)/c-sapphire by antenna-edge-type microwave plasma chemical vapor deposition 2020-09-18 |
|
0.40 |
|
Semidry release of nanomembranes for tubular origami 2020-09-18 |
|
1 |
|
Biodegradable cellular polylactic acid ferroelectrets with strong longitudinal and transverse piezoelectricity 2020-09-17 |
|
0.36 |
|
Black phosphorus field effect transistors stable in harsh conditions via surface engineering 2020-09-17 |
|
0.95 |
|
Controllable laser output of high-quality cylindrical vector beam through intra-cavity mode conversion 2020-09-17 |
|
0.96 |
|
Spin–orbit torque-induced multiple magnetization switching behaviors in synthetic antiferromagnets 2020-09-17 |
|
1 |
|
Strong interface-induced spin-charge conversion in YIG/Cr heterostructures 2020-09-17 |
|
0.98 |
|
Boundary-dependent corner states in topological acoustic resonator array 2020-09-16 |
|
1 |
|
Giant thermal magnetoresistance driven by graphene magnetoplasmon 2020-09-16 |
|
0.83 |
|
Mesoscopic capacitance oscillations due to quantum dynamic coherence in an interacting quantum capacitor 2020-09-14 |
|
1 |
|
Pressure effects on the lattice vibrations and ultrafast photocarrier dynamics in 2H–TaS2 2020-09-11 |
|
1 |
|
Controlled giant magnetoresistance and spin–valley transport in an asymmetrical MoS2 tunnel junction 2020-09-10 |
|
1 |
|
Effects of annealing on the interfacial properties and energy-band alignment of AlN dielectric on 4H–SiC 2020-09-10 |
|
1 |
|
Enhanced output performance of flexible piezoelectric energy harvester by using auxetic graphene films as electrodes 2020-09-10 |
|
1 |
|
Misfit epitaxial strain manipulated transport properties in cubic In2O3 hetero-epilayers 2020-09-10 |
|
0.85 |
|
Strain-tunable magnetism and nodal loops in monolayer MnB 2020-09-10 |
|
1 |
|
Sensitive detection of excited energy levels in rare-earth optical materials by a magneto-optical resonant excitation technique 2020-09-09 |
|
1 |
|
Temperature-dependent phonon mode and interband electronic transition evolutions of ε-InSe films derived by pulsed laser deposition 2020-09-08 |
|
1 |
|
Directional acoustic emission via topological insulators based on cavity-channel networks 2020-09-03 |
|
1 |
|
Signature of p-type semiconductor features in paper-based back gate metal-organic framework thin-film transistors 2020-09-03 |
|
1 |
|
Flexible electronic synapse enabled by ferroelectric field effect transistor for robust neuromorphic computing 2020-09-02 |
|
1 |
|
Pseudo-thermal ghost imaging with “learned” wavelength conversion 2020-09-02 |
|
1 |
|
Visible-to-near-infrared organic photodiodes with performance comparable to commercial silicon-based detectors 2020-09-02 |
|
1 |
|
Bi-component symbiotic crystal 2020-09-01 |
|
1 |
|
Extraordinary acoustic transmission of a decorated window without ventilation 2020-09-01 |
|
1 |
|
Photo-assisted deposited titanium dioxide for all-inorganic CsPbI2Br perovskite solar cells with high efficiency exceeding 13.6% 2020-09-01 |
|
1 |
|
Realization of programmable nanomechanical lattice with both nearest-neighboring and next-nearest-neighboring couplings 2020-09-01 |
|
1 |
|
Anomalous and topological Hall effect in Cu doped Sb2Te3 topological insulator 2020-08-31 |
|
0.09 |
|
Current-induced out-of-plane effective magnetic field in antiferromagnet/heavy metal/ferromagnet/heavy metal multilayer 2020-08-31 |
|
1 |
|
Experimental demonstration of underwater ultrasound cloaking based on metagrating 2020-08-31 |
|
1 |
|
Impact of the resistive switching effects in ZnMgO electron transport layer on the aging characteristics of quantum dot light-emitting diodes 2020-08-31 |
|
1 |
|
Interfacial charge transfer exciton enhanced by plasmon in 2D in-plane lateral and van der Waals heterostructures 2020-08-31 |
|
1 |
|
High-Q hybridized resonance in a plasmonic metasurface of asymmetric aligned magnetic dipoles 2020-08-28 |
|
0.88 |
|
Low-temperature wafer-scale fabrication of vertical VO2 nanowire arrays 2020-08-28 |
|
0.91 |
|
Electric field control of molecular magnetic state by two-dimensional ferroelectric heterostructure engineering 2020-08-27 |
|
0.60 |
|
Enhancement of the spin–orbit torque efficiency in W/Cu/CoFeB heterostructures via interface engineering 2020-08-27 |
|
0.65 |
|
Heterogeneous photoresponse of individual grain in all-inorganic perovskite solar cells 2020-08-27 |
|
1 |
|
Large-range frequency tuning of a narrow-linewidth quantum emitter 2020-08-27 |
|
0.08 |
|
Photodoping of graphene/silicon van der Waals heterostructure observed by terahertz emission spectroscopy 2020-08-27 |
|
0.88 |
|
Trion-to-exciton upconversion dynamics in monolayer WSe2 2020-08-27 |
|
1 |
|
Unraveling magneto-structural coupling of Ni2MnGa alloy under the application of stress and magnetic field using in situ polarized neutron diffraction 2020-08-27 |
|
0.67 |
|
1/f Noise in epitaxial sidewall graphene nanoribbons 2020-08-26 |
|
0.10 |
|
Acoustical ghost imaging 2020-08-26 |
|
1 |
|
Evaluating interface roughness and micro-fluctuation potential of InAs/GaSb superlattices by mid-infrared magnetophotoluminescence 2020-08-26 |
|
1 |
|
Structural disorder, sublattice melting, and thermo-elastic properties of anti-perovskite Li3OBr under high pressure and temperature 2020-08-26 |
|
0.75 |
|
Electrically tunable high Curie temperature two-dimensional ferromagnetism in van der Waals layered crystals 2020-08-25 |
|
0.33 |
|
Formation of nanodiamond by pulsed discharge of carbon fiber wires 2020-08-25 |
|
1 |
|
High harmonic optomechanical oscillations in the lithium niobate photonic crystal nanocavity 2020-08-25 |
|
0.57 |
|
Hybrid CARS spectroscopy based on a high-repetition-rate all-PM-fiber laser source 2020-08-25 |
|
0.80 |
|
Realization of mutual synchronization of spin torque nano-oscillators under room temperature by noise reduction technique 2020-08-25 |
|
1 |
|
Spin-controlled massive channels of hybrid-order Poincaré sphere beams 2020-08-25 |
|
1 |
|
Dual-band microwave detector based on magnetic tunnel junctions 2020-08-21 |
|
0.75 |
|
Trifunctional metasurface for manipulating linearly and circularly polarized waves in transmission and reflection modes 2020-08-21 |
|
1 |
|
Magnetic relaxation dependences on the central ions for Ln (Ln = Tb, Dy, Er) phthalocyanines 2020-08-20 |
|
1 |
|
Noise reduction of spin torque oscillator by phase-locked loop with combinational frequency tuning method 2020-08-20 |
|
1 |
|
Highly efficient nondoped bilayer organic light-emitting diodes based on triphenyl phosphine oxide protected iridium complexes 2020-08-19 |
|
1 |
|
Modulation of optical switching characteristics in MoS2/HfO2/p-Si structures 2020-08-19 |
|
1 |
|
Revealing mechanism of obtaining the valence band maximum via photoelectron spectroscopy in organic halide perovskite single crystals 2020-08-19 |
|
1 |
|
Composition dependent mobility and bandgaps in (La0.05BaxSr0.95−x)SnO3 epitaxial films 2020-08-18 |
|
1 |
|
Enhancing the photoelectrical performance of graphene/4H-SiC/graphene detector by tuning a Schottky barrier by bias 2020-08-18 |
|
1 |
|
Piezotronic effect on Rashba spin–orbit coupling based on MAPbI3/ZnO heterostructures 2020-08-18 |
|
0.88 |
|
Reconfigurable spin orbit logic device using asymmetric Dzyaloshinskii–Moriya interaction 2020-08-18 |
|
1 |
|
Remarkable magnetoelectric effect in single crystals of honeycomb magnet Mn4Nb2O9 2020-08-18 |
|
1 |
|
High gain and high ultraviolet/visible rejection ratio photodetectors using p-GaN/AlGaN/GaN heterostructures grown on Si 2020-08-17 |
|
1 |
|
Effective passivation of black phosphorus against atmosphere by quasi-monolayer of F4TCNQ molecules 2020-08-14 |
|
0.95 |
|
Magnetocaloric effect manipulated through interchain exchange coupling in nanochain arrays 2020-08-14 |
|
1 |
|
Regulating the anomalous Hall and Nernst effects in Heusler-based trilayers 2020-08-14 |
|
0.77 |
|
Current-induced torques in black phosphorus/permalloy bilayers due to crystal symmetry 2020-08-13 |
|
1 |
|
Hybrid metamaterials enable multifunctional manipulation of mechanical waves on solid-fluid interfaces 2020-08-13 |
|
1 |
|
Two-dimensional BP/β-AsP van der Waals heterostructures as promising photocatalyst for water splitting 2020-08-13 |
|
1 |
|
Cherenkov-type three-dimensional breakdown behavior of the Bloch-point domain wall motion in the cylindrical nanowire 2020-08-11 |
|
0.50 |
|
Laminated low-melting-point-alloy electrodes for vacuum-free-processed quantum-dot light-emitting-diodes 2020-08-11 |
|
1 |
|
Graphene assisting magnetic alignment of a high-performance semiconducting polymer for improved carrier transport 2020-08-10 |
|
1 |
|
Pressure tuning of electron transfer rate in near-infrared PbS-anthraquinone complexes 2020-08-10 |
|
0.90 |
|
Identification of excess charge carriers in InP-based quantum-dot light-emitting diodes 2020-08-07 |
|
1 |
|
Intrinsic piezoelectricity in (K,Na)NbO3-based lead-free single crystal: Piezoelectric anisotropy and its evolution with temperature 2020-08-07 |
|
1 |
|
Magnetic transition behavior and large topological Hall effect in hexagonal Mn2−xFe1+xSn (x = 0.1) magnet 2020-08-07 |
|
1 |
|
Negative effect of oxygen vacancies on ferromagnetism in Ru-doped BaSnO3 materials 2020-08-07 |
|
1 |
|
Realizing high thermoelectric performance in p-type Si1-x-yGexSny thin films at ambient temperature by Sn modulation doping 2020-08-07 |
|
0.45 |
|
Room-temperature multiferroic behavior in layer-structured Aurivillius phase ceramics 2020-08-07 |
|
0.36 |
|
Transition metal dichalcogenides thyristor realized by solid ionic conductor gate induced doping 2020-08-07 |
|
1 |
|
Near-field radiative heat transfer between twisted nanoparticle gratings 2020-08-06 |
|
0.50 |
|
Size-dependent anomalous Hall effect in noncollinear antiferromagnetic Mn3Sn films 2020-08-06 |
|
1 |
|
Skyrmion bubbles stabilization in confined hole and trench materials 2020-08-06 |
|
1 |
|
Dynamic behavior of OH and its atomic contrast with O adatom on the Ti site of TiO2(110) at 78 K by atomic force microscopy imaging 2020-08-04 |
|
0.75 |
|
Micrometer-scale InP selectively grown on SOI for fully integrated Si-photonics 2020-08-04 |
|
1 |
|
Spin filtering in germanium/silicon core/shell nanowires with pseudo-helical gap 2020-08-04 |
|
0.30 |
|
Trapping of sub-wavelength microparticles and cells in resonant cylindrical shells 2020-08-04 |
|
1 |
|
Improved nucleation of AlN on in situ nitrogen doped graphene for GaN quasi-van der Waals epitaxy 2020-08-03 |
|
1 |
|
Reduced work function and improved field emission stability of ZrC nanowires upon surface oxidation 2020-08-03 |
|
0.17 |
|
Modulation of the electric and magnetic properties by Ti non-stoichiometry in 0.70BiFeO3-0.30BaTixO3 ceramics 2020-07-30 |
|
1 |
|
Origin of superb electrical insulating capability of cellulose-liquid biphasic dielectrics by interfacial charge behaviors 2020-07-30 |
|
1 |
|
The effect of solution processed nickel oxide and nickel oxide by-products on planar MAPbI3 perovskite solar cells 2020-07-30 |
|
1 |
|
Broadband terahertz wave emission from liquid metal 2020-07-29 |
|
0.38 |
|
Enhanced thermoelectric performance of PbTe based materials by Bi doping and introducing MgO nanoparticles 2020-07-29 |
|
1 |
|
Spin orientation and strain tuning valley polarization with magneto-optic Kerr effects in ferrovalley VS2 monolayer 2020-07-29 |
|
1 |
|
Active bidirectionally controlled terahertz interference fringe shift in DMSO-doped PEDOT:PSS film 2020-07-28 |
|
1 |
|
Fluorescent digital image correlation applied for macroscale deformation measurement 2020-07-28 |
|
1 |
|
Switchable directional sound emission with improved field confinement based on topological insulators 2020-07-28 |
|
0.30 |
|
A synergetic hybrid mechanism of piezoelectric and triboelectric for galloping wind energy harvesting 2020-07-27 |
|
1 |
|
Purcell enhancement of a deterministically coupled quantum dot in an SU-8 laser patterned photonic crystal heterostructure 2020-07-27 |
|
0.20 |
|
Structural and mechanical properties of magnesium aluminate nanoceramics under high pressure 2020-07-27 |
|
1 |
|
Thermally enhanced hole injection and breakdown in a Schottky-metal/p-GaN/AlGaN/GaN device under forward bias 2020-07-27 |
|
1 |
|
Variable supercells in layered bismuth manganite controlled by oxygen pressure 2020-07-27 |
|
1 |
|
Free-space self-interference microresonator with tunable coupling regimes 2020-07-24 |
|
1 |
|
Faithful digital holographic reconstruction using a sparse sensor array 2020-07-23 |
|
1 |
|
Experimental observation of ferroelectricity in ferrimagnet MnCr2S4 2020-07-22 |
|
1 |
|
Experimentally tailoring acoustic topological edge states by selecting the boundary type 2020-07-22 |
|
1 |
|
Piezoelectric inertial rotary actuator operating in two-step motion mode for eliminating backward motion 2020-07-22 |
|
1 |
|
Ultra-low threshold green InGaN quantum dot microdisk lasers grown on silicon 2020-07-22 |
|
1 |
|
One-step facile preparation of zinc-based hydroquinone hybrid nanoporous thin films by molecular layer deposition 2020-07-21 |
|
1 |
|
Electron paramagnetic resonance and theoretical study of gallium vacancy in β-Ga2O3 2020-07-20 |
|
0.07 |
|
Low-energy electron inelastic mean free path for monolayer graphene 2020-07-20 |
|
0.28 |
|
Significantly enhanced electrical properties in CaBi2Nb2O9-based high-temperature piezoelectric ceramics 2020-07-20 |
|
1 |
|
Stress-modulated optimization of polymorphic phase transition in Li-doped (K,Na)NbO3 2020-07-20 |
|
0.22 |
|
Ultrahigh tunneling magnetoresistance in van der Waals and lateral magnetic tunnel junctions formed by intrinsic ferromagnets Li0.5CrI3 and CrI3 2020-07-17 |
|
1 |
|
Amorphous boron nitride for vacuum-ultraviolet photodetection 2020-07-16 |
|
1 |
|
Superoscillatory quartz lens with effective numerical aperture greater than one 2020-07-16 |
|
0.13 |
|
Suppressed resistance drift from short range order of amorphous GeTe ultrathin films 2020-07-16 |
|
1 |
|
A method to improve the specific contact resistance of 4H-SiC Ohmic contact through increasing the ratio of sp2-carbon 2020-07-15 |
|
0.83 |
|
Chemical renormalization of the paraelectric–ferroelectric phase transition in PbTiO3−BiB′0.5B″0.5O3 solid solutions with tetragonal symmetry 2020-07-15 |
|
0.20 |
|
Measurement of undercut etching by contact resonance atomic force microscopy 2020-07-15 |
|
1 |
|
Microwave response of the chiral helimagnetic MnNb3S6 2020-07-15 |
|
1 |
|
Ultrasonic tunable focusing by a stretchable phase-reversal Fresnel zone plate 2020-07-15 |
|
1 |
|
A 1.86-kV double-layered NiO/β-Ga2O3 vertical p–n heterojunction diode 2020-07-14 |
|
1 |
|
Electron beam irradiation enhanced varistor properties in ZnO nanowire 2020-07-14 |
|
1 |
|
Enhanced all-optical switching and domain wall velocity in annealed synthetic-ferrimagnetic multilayers 2020-07-14 |
|
0.33 |
|
High quality AlN film grown on a nano-concave-circle patterned Si substrate with an AlN seed layer 2020-07-14 |
|
1 |
|
Quantum dense metrology by an SU(2)-in-SU(1,1) nested interferometer 2020-07-14 |
|
0.75 |
|
Speed enhancement of magnetic logic-memory device by insulator-to-metal transition 2020-07-14 |
|
0.89 |
|
Terahertz master-oscillator power-amplifier quantum Cascade laser with controllable polarization 2020-07-14 |
|
0.75 |
|
Ultracompact metaimage display and encryption with a silver nanopolarizer based metasurface 2020-07-14 |
|
1 |
|
A high-sensitivity flexible electric skin using a liquid-core PVDF fiber 2020-07-13 |
|
1 |
|
Axially controllable multiple orbital angular momentum beam generator 2020-07-13 |
|
1 |
|
Detection of chirality of single-walled carbon nanotubes on hexagonal boron nitride 2020-07-13 |
|
0.78 |
|
Direct observation of multiple magnetic transitions in the La3NiGe2-type compounds 2020-07-13 |
|
1 |
|
Early stage degradation related to dislocation evolution in neutron irradiated AlGaN/GaN HEMTs 2020-07-13 |
|
1 |
|
Heterostructure design to achieve high quality, high density GaAs 2D electron system with g-factor tending to zero 2020-07-13 |
|
0.29 |
|
Influence of dislocations on thermal conductivity of strontium titanate 2020-07-13 |
|
0.33 |
|
Phase transition of Bi5Ti3FeO15 ceramics discovered by Raman spectroscopy and in situ synchrotron XRD under stress field 2020-07-13 |
|
1 |
|
Sulfur regulation of boron doping and growth behavior for high-quality diamond in microwave plasma chemical vapor deposition 2020-07-13 |
|
1 |
|
Comprehensive insights into defect passivation and charge dynamics for FA0.8MA0.15Cs0.05PbI2.8Br0.2 perovskite solar cells 2020-07-10 |
|
1 |
|
Current-driven skyrmionium in a frustrated magnetic system 2020-07-09 |
|
0.60 |
|
Hole injection in perovskite light-emitting device with PEDOT:PSS/perovskite interface via MS contact 2020-07-09 |
|
1 |
|
Investigations of monoclinic- and orthorhombic-based (BxGa1−x)2O3 alloys 2020-07-09 |
|
0.33 |
|
Tuning topological states in a Ni-hexaaminobenzene framework by NO2 adsorption 2020-07-09 |
|
1 |
|
High-efficiency focused optical vortex generation with geometric gap-surface plasmon metalenses 2020-07-08 |
|
0.25 |
|
Polarization-insensitive terahertz spoof localized surface plasmon-induced transparency based on lattice rotational symmetry 2020-07-08 |
|
0.40 |
|
Thermal convection-diffusion crystal for prohibition and modulation of wave-like temperature profiles 2020-07-08 |
|
1 |
|
Two-dimensional mechanical metamaterials with bending-induced expansion behavior 2020-07-08 |
|
1 |
|
Third harmonic generation in Dirac semimetal Cd3As2 2020-07-07 |
|
1 |
|
Direct observation of ferrimagnetic ordering in inverse Heusler alloy Mn2CoAl 2020-07-06 |
|
0.83 |
|
Interfacial charge and strain effects on lanthanum doped barium stannate thin film under ferroelectric gating 2020-07-06 |
|
1 |
|
Versatile two-dimensional boron monosulfide polymorphs with tunable bandgaps and superconducting properties 2020-07-06 |
|
1 |
|
Antimonene nanosheets fabricated by laser irradiation technique with outstanding nonlinear absorption responses 2020-07-02 |
|
1 |
|
A hybrid structure light-emitting device based on a CsPbBr3 nanoplate and two-dimensional materials 2020-07-01 |
|
0.75 |
|
Acoustic tweezing for both Rayleigh and Mie particles based on acoustic focused petal beams 2020-07-01 |
|
1 |
|
Direct evidence of hydrogen interaction with carbon: C–H complex in semi-insulating GaN 2020-06-30 |
|
1 |
|
Bound state in the continuum in topological inductor–capacitor circuit 2020-06-29 |
|
1 |
|
Evolutions of optical constants, interband electron transitions, and bandgap of Sn-doped CH3NH3PbI3 perovskite films 2020-06-29 |
|
0.83 |
|
Suspended photonic crystal membranes in AlGaAs heterostructures for integrated multi-element optomechanics 2020-06-29 |
|
0.22 |
|
Theoretical investigation of air breakdown direct current triboelectric nanogenerator 2020-06-29 |
|
0.52 |
|
Verification of topological magnetic properties of patterned ferromagnetic films 2020-06-29 |
|
1 |
|
Adjustable super-resolution microscopy with diffractive spot array illumination 2020-06-26 |
|
1 |
|
Does sunlight always accelerate water droplet evaporation? 2020-06-26 |
|
0.83 |
|
Light-induced degradation and self-healing inside CH3NH3PbI3-based solar cells 2020-06-26 |
|
0.91 |
|
The growth and characteristics of In2Se3/(Bi1−xInx)2Se3 superlattices with asymmetric graded interfaces by molecular beam epitaxy 2020-06-25 |
|
1 |
|
WO3/ZnO nanowire heterojunction as hole transport channel for building up persistent holographic fringes 2020-06-25 |
|
1 |
|
Ultrabroadband and independent polarization of optical amplification with InGaAs-based indium-rich cluster quantum-confined structure 2020-06-24 |
|
1 |
|
Atomic-scale imaging of interfacial polarization in cuprate-titanate heterostructures 2020-06-23 |
|
0.71 |
|
Droplet motion on contrasting striated surfaces 2020-06-23 |
|
0.08 |
|
Optoelectronic domain-wall motion for logic computing 2020-06-23 |
|
0.50 |
|
Single-shot multi-planar wave-front measurement with multi-focal Fibonacci sieves 2020-06-23 |
|
1 |
|
All-organic flexible logical computing system based on electrical polarization of ferroelectric polymers 2020-06-22 |
|
1 |
|
Reversible transition between bipolar resistive switching and threshold switching in 2D layered III–VI semiconductor GaSe 2020-06-22 |
|
1 |
|
Terahertz faraday rotation of magneto-optical films enhanced by helical metasurface 2020-06-22 |
|
1 |
|
The formation mechanism of voids in physical vapor deposited AlN epilayer during high temperature annealing 2020-06-22 |
|
1 |
|
Multidimensional four-wave-mixing spectroscopy with squeezed light 2020-06-19 |
|
0.60 |
|
Spin-resolved near-field scanning optical microscopy for mapping of the spin angular momentum distribution of focused beams 2020-06-19 |
|
1 |
|
Terahertz single-pixel near-field imaging based on active tunable subwavelength metallic grating 2020-06-19 |
|
0.89 |
|
All-fiber focused beam generator integrated on an optical fiber tip 2020-06-16 |
|
1 |
|
Design and fabrication of field-plated normally off β-Ga2O3 MOSFET with laminated-ferroelectric charge storage gate for high power application 2020-06-16 |
|
1 |
|
Non-invasive optical focusing inside strongly scattering media with linear fluorescence 2020-06-16 |
|
0.10 |
|
STEM imaging artifacts with three-fold astigmatism in monolayer transition metal dichalcogenides 2020-06-16 |
|
0.40 |
|
Spontaneous thermocapillary motion of condensation droplets 2020-06-16 |
|
1 |
|
Study of the perpendicular magnetic anisotropy, spin–orbit torque, and Dzyaloshinskii–Moriya interaction in the heavy metal/CoFeB bilayers with Ir22Mn78 insertion 2020-06-16 |
|
0.50 |
|
Theoretical and experimental studies on broadband photoacoustic response of surface plasmon sensing 2020-06-16 |
|
1 |
|
An experimental study for characterization of size-dependence in microstructures via electrostatic pull-in instability technique 2020-06-15 |
|
0.25 |
|
Cantilever-based ferroelectret energy harvesting 2020-06-15 |
|
0.14 |
|
High performance solar-blind UV detector based on Hf0.38Sn0.62O2 epitaxial film 2020-06-15 |
|
1 |
|
In situ investigation of interfacial properties of Sb2Se3 heterojunctions 2020-06-15 |
|
0.88 |
|
Intrinsic role of ↑↑↓↓-type magnetic structure on magnetoelectric coupling in Y2NiMnO6 2020-06-15 |
|
1 |
|
Magnetic field direction dependence of topological Hall effect like features in synthetic ferromagnetic and antiferromagnetic multilayers 2020-06-15 |
|
1 |
|
Spin–orbit torque driven multi-level switching in He+ irradiated W–CoFeB–MgO Hall bars with perpendicular anisotropy 2020-06-15 |
|
0.44 |
|
Robust waveguiding in substrate-integrated topological photonic crystals 2020-06-12 |
|
0.86 |
|
Al diffusion at AlN/Si interface and its suppression through substrate nitridation 2020-06-09 |
|
1 |
|
Linear array of charge sensitive infrared phototransistors for long wavelength infrared detection 2020-06-09 |
|
1 |
|
Structured illumination microscopy using digital micro-mirror device and coherent light source 2020-06-09 |
|
1 |
|
Perpendicular magnetic anisotropy in SrTiO3/Co/Pt films induced by oxygen diffusion from CaTiO3 spacer layer 2020-06-08 |
|
1 |
|
Second harmonic generation based joint transform correlator for human face and QR code recognitions 2020-06-08 |
|
1 |
|
Error-free data transmission through fast broadband all-optical modulation in graphene–silicon optoelectronics 2020-06-05 |
|
0.21 |
|
The mechanism exploration for zero-field ferromagnetism in intrinsic topological insulator MnBi2Te4 by Bi2Te3 intercalations 2020-06-05 |
|
0.92 |
|
Annular stratification of acoustically levitated aqueous two-phase-system drops 2020-06-04 |
|
1 |
|
Broadband generation of photon-pairs from a CMOS compatible device 2020-06-04 |
|
0.60 |
|
In situ TEM revealing pretreatment and interface effects in Ge2Sb2Te5 2020-06-04 |
|
1 |
|
Laser-induced magnetization dynamics in a van der Waals ferromagnetic Cr2Ge2Te6 nanoflake 2020-06-04 |
|
1 |
|
Ultralow operation voltages of a transparent memristor based on bilayer ITO 2020-06-04 |
|
1 |
|
Classically entangled Ince–Gaussian modes 2020-06-03 |
|
0.86 |
|
Inverse spin Hall photocurrent in thin-film MoTe2 2020-06-03 |
|
1 |
|
Preparation and characterization of a flexible ferroelectric tunnel junction 2020-06-03 |
|
1 |
|
Broadband integrative acoustic asymmetric focusing lens based on mode-conversion meta-atoms 2020-06-02 |
|
1 |
|
Chiral-anomaly induced large negative magnetoresistance and nontrivial π-Berry phase in half-Heusler compounds RPtBi (R=Tb, Ho, and Er) 2020-06-02 |
|
1 |
|
Controlled support of a magnetic fluid at a superhydrophobic interface 2020-06-02 |
|
1 |
|
Iron-doped VSe2 nanosheets for enhanced hydrogen evolution reaction 2020-06-02 |
|
1 |
|
Lateral domain wall oscillations in IMA/PMA bilayered nano-strips driven by a perpendicular current: A type of domain wall based oscillators 2020-06-02 |
|
1 |
|
The accurate measurement of spin orbit torque by utilizing the harmonic longitudinal voltage with Wheatstone bridge structure 2020-06-02 |
|
1 |
|
Characterization and analysis of low-temperature time-to-failure behavior in forward-biased Schottky-type p-GaN gate HEMTs 2020-06-01 |
|
1 |
|
Effect of nano-SiO2 hybridization of PDMS substrate on strain mismatch of flexible electronic film 2020-06-01 |
|
1 |
|
Variable range hopping mechanism and modeling of isolation leakage current in GaN-based high-electron-mobility transistors 2020-06-01 |
|
0.77 |
|
Manipulation of Gilbert damping in ultrathin half-metallic Co2 FeAl 1 + x by composition-deficiency-compensation 2020-05-29 |
|
0.87 |
|
Controlled bunching approach for achieving high efficiency active region in AlGaN-based deep ultraviolet light-emitting devices with dual-band emission 2020-05-28 |
|
1 |
|
Goos–Hänchen effect enabled optical differential operation and image edge detection 2020-05-27 |
|
1 |
|
Highly stable in-fiber integrated silica microresonator 2020-05-27 |
|
1 |
|
Negative magnetoresistance effect of PtSe 2 film in variable range hopping regime 2020-05-27 |
|
0.83 |
|
Phase transition of non-Hermitian topological edge states in microwave regime 2020-05-27 |
|
1 |
|
Baking and plasma pretreatment of sapphire surfaces as a way to facilitate the epitaxial plasma-enhanced atomic layer deposition of GaN thin films 2020-05-26 |
|
0.92 |
|
Diffraction control in a non-Hermitian acoustic grating 2020-05-26 |
|
1 |
|
Enhancement of p-type conductivity of monolayer hexagonal boron nitride by driving Mg incorporation through low-energy path with N-rich condition 2020-05-26 |
|
1 |
|
High-speed infrared two-dimensional platinum diselenide photodetectors 2020-05-26 |
|
1 |
|
Multiscale characterization of the joint bonded by Cu@Ag core@shell nanoparticles 2020-05-26 |
|
0.64 |
|
Generation of pure-state single photons with high heralding efficiency by using a three-stage nonlinear interferometer 2020-05-21 |
|
0.94 |
|
Substrate dependent terahertz response of monolayer WS2 2020-05-20 |
|
0.75 |
|
Visible and near-infrared dual-band photodetector based on gold–silicon metamaterial 2020-05-20 |
|
1 |
|
Optical vortex with multi-fractional orders 2020-05-19 |
|
1 |
|
Optimizing the piezoelectric vibration of Pb(Mg1/3Nb2/3)O3-0.25PbTiO3 single crystal by alternating current polarization for ultrasonic transducer 2020-05-19 |
|
1 |
|
Realizing Anderson localization of surface plasmon polaritons and enhancing their interactions with excitons in 2D disordered nanostructures 2020-05-19 |
|
1 |
|
Solid and hollow metallic glass microneedles for transdermal drug-delivery 2020-05-19 |
|
0.10 |
|
Thickness-dependent thermal conductivity of mechanically exfoliated β-Ga2O3 thin films 2020-05-19 |
|
0.08 |
|
Degradation in AlGaN-based UV-C LEDs under constant current stress: A study on defect behaviors 2020-05-18 |
|
1 |
|
Flexible measurement of high-order optical orbital angular momentum with a variable cylindrical lens pair 2020-05-18 |
|
1 |
|
Formation of laterally ordered quantum dot molecules by in situ nanosecond laser interference 2020-05-18 |
|
0.13 |
|
Fowler–Nordheim tunneling-assisted enhancement of tunneling electroresistance effect through a composite barrier 2020-05-18 |
|
0.63 |
|
In situ growth of B4C nanowires on activated carbon felt to improve microwave absorption performance 2020-05-18 |
|
0.87 |
|
Narrow linewidth characteristics of interband cascade lasers 2020-05-18 |
|
1 |
|
Tunable magnetic properties in van der Waals crystals (Fe1−xCox)5GeTe2 2020-05-18 |
|
1 |
|
Band engineering in epitaxial monolayer transition metal dichalcogenides alloy MoxW1−xSe2 thin films 2020-05-14 |
|
1 |
|
Helical structures with switchable and hierarchical chirality 2020-05-14 |
|
0.94 |
|
Inferring the magnetic anisotropy of a nanosample through dynamic cantilever magnetometry measurements 2020-05-14 |
|
1 |
|
The unusual spin reorientation transition and exchange bias effect in Er0.6Dy0.4FeO3 single crystal 2020-05-14 |
|
0.63 |
|
Linear dependence of skyrmion velocity on response resonance frequency of local magnetization 2020-05-13 |
|
1 |
|
Realizing single-mode lasing of cadmium selenide nanoribbons with strain engineering 2020-05-13 |
|
1 |
|
Bright infra-red quantum dot light-emitting diodes through efficient suppressing of electrons 2020-05-12 |
|
1 |
|
Improving near-room-temperature thermoelectrics in SnTe–MnTe alloys 2020-05-12 |
|
1 |
|
Single atoms or not? The limitation of EXAFS 2020-05-12 |
|
1 |
|
Thermoelectric probe of defect state induced by ionic liquid gating in vanadium dioxide 2020-05-12 |
|
0.22 |
|
Characteristics and temperature-field-thickness evolutions of magnetic domain structures in van der Waals magnet Fe3GeTe2 nanolayers 2020-05-11 |
|
1 |
|
Comparative study on electrochemical charge storage behavior of FeCo2S4 electrodes with different dimensional nanostructures 2020-05-11 |
|
1 |
|
Detecting the out-of-time-order correlations of dynamical quantum phase transitions in a solid-state quantum simulator 2020-05-11 |
|
0.83 |
|
Manipulating leakage behavior via thickness in epitaxial BaZr0.35Ti0.65O3 thin film capacitors 2020-05-11 |
|
1 |
|
Manipulation of the zero-damping conditions and unidirectional invisibility in cavity magnonics 2020-05-11 |
|
0.28 |
|
RuVO2 alloy epitaxial films: Lowered insulator–metal transition temperature and retained modulation capacity 2020-05-11 |
|
0.90 |
|
Solution-processed amorphous Ga2O3:CdO TFT-type deep-UV photodetectors 2020-05-11 |
|
0.86 |
|
Spin–orbit torque-based reconfigurable physically unclonable functions 2020-05-11 |
|
1 |
|
The magnetic, electronic, and light-induced topological properties in two-dimensional hexagonal FeX2 (X = Cl, Br, I) monolayers 2020-05-11 |
|
0.43 |
|
Modulation of magnetic damping in antiferromagnet/CoFeB heterostructures 2020-05-07 |
|
1 |
|
Vortex trapping and separation of particles in shear thinning fluids 2020-05-07 |
|
0.25 |
|
Large anisotropic topological Hall effect in a hexagonal non-collinear magnet Fe5Sn3 2020-05-06 |
|
1 |
|
Coupling of polarization orientations of the ferroelectric layers in an oxide sandwich structure 2020-05-05 |
|
1 |
|
Nanodomain patterns in ultra-tetragonal lead titanate (PbTiO3) 2020-05-05 |
|
0.33 |
|
A tunable electromagnetic acoustic switch 2020-05-04 |
|
1 |
|
Dense ferroelectric-ferroelastic domain structures in rhombohedral PMN-28PT single crystals 2020-05-04 |
|
0.50 |
|
First and second order rotational transitions of skyrmion crystal in multiferroic Cu2OSeO3 under electric field 2020-05-04 |
|
1 |
|
Light field imaging through a single multimode fiber for OAM-multiplexed data transmission 2020-05-04 |
|
1 |
|
Realizing isotropic negative thermal expansion covering room temperature by breaking the superstructure of ZrV2O7 2020-05-04 |
|
1 |
|
Single-spin scanning magnetic microscopy with radial basis function reconstruction algorithm 2020-05-04 |
|
1 |
|
The in-plane anisotropy of the effective g factors in Al0.25Ga0.75N/GaN based quantum point contacts with narrow channels 2020-05-04 |
|
1 |
|
Enhancement of DC/AC resistive switching performance in AlOx memristor by two-technique bilayer approach 2020-04-30 |
|
1 |
|
The electric pulses induced multi-resistance states in the hysteresis temperature range of 1T-TaS2 and 1T-TaS1.6Se0.4 2020-04-30 |
|
0.75 |
|
Discovery of multiferroics with tunable magnetism in two-dimensional lead oxide 2020-04-28 |
|
1 |
|
Femtosecond imbalanced time-stretch spectroscopy for ultrafast gas detection 2020-04-28 |
|
1 |
|
A GaN/AlN quantum cascade detector with a broad response from the mid-infrared (4.1 μm) to the visible (550 nm) spectral range 2020-04-27 |
|
0.68 |
|
Generation, electric detection, and orbital-angular momentum tunneling of twisted magnons 2020-04-27 |
|
0.50 |
|
III–V micro- and nano-lasers deposited on amorphous SiO2 2020-04-27 |
|
1 |
|
Improved charge–discharge cycling durability of PVDF dielectrics with MgO nanofillers 2020-04-27 |
|
1 |
|
Near-zero temperature coefficient of resistivity in LaFe9.45Al3.55 compound over 5–300 K 2020-04-27 |
|
1 |
|
Non-local edge enhanced imaging with incoherent thermal light 2020-04-27 |
|
0.86 |
|
Non-resonant metasurface for broadband elastic wave mode splitting 2020-04-27 |
|
0.56 |
|
Radiation impact of swift heavy ion beams on double-interface CoFeB/MgO magnetic tunnel junctions 2020-04-27 |
|
0.86 |
|
Synergistically promoted thermoelectric performance of SnTe by alloying with NaBiTe2 2020-04-27 |
|
1 |
|
Plasmonic nano-dumbbells for enhanced photothermal and photodynamic synergistic damage of cancer cells 2020-04-24 |
|
1 |
|
Raman fingerprints and exciton-phonon coupling in 2D ternary layered semiconductor InSeBr 2020-04-24 |
|
0.21 |
|
Acoustic vortices with high-order orbital angular momentum by a continuously tunable metasurface 2020-04-23 |
|
0.44 |
|
Low-power all-optical tunable sharp trapped-mode resonances in asymmetrical planar WS2 exciton-polariton gratings 2020-04-23 |
|
1 |
|
Multiple-frequency perfect absorption by hybrid membrane resonators 2020-04-22 |
|
1 |
|
Smaller antenna-gate gap for higher sensitivity of GaN/AlGaN HEMT terahertz detectors 2020-04-22 |
|
0.92 |
|
Thermoelectric modulation by intrinsic defects in superionic conductor AgxCrSe2 2020-04-22 |
|
1 |
|
An anomalous wave formation at the Al/Cu interface during magnetic pulse welding 2020-04-21 |
|
0.13 |
|
Magnetic flux pumping in superconducting loop containing a Josephson ψ junction 2020-04-21 |
|
0.22 |
|
Strongly polarized quantum well infrared photodetector with metallic cavity for narrowband wavelength selective detection 2020-04-21 |
|
1 |
|
Terahertz emission from in-plane and out-of-plane dipoles in layered SnS2 crystal 2020-04-21 |
|
1 |
|
All-electrical manipulation of magnetization in magnetic tunnel junction via spin–orbit torque 2020-04-20 |
|
1 |
|
Design of terahertz-wave Doppler interferometric velocimetry for detonation physics 2020-04-20 |
|
1 |
|
High performance CsPbBr3 quantum dots photodetectors by using zinc oxide nanorods arrays as an electron-transport layer 2020-04-20 |
|
1 |
|
High-temperature quantum anomalous Hall insulator in two-dimensional Bi2ON 2020-04-20 |
|
1 |
|
PLD-derived Ge 2 Sb 2 Te 5 phase-change films with extreme bending stability for flexible device applications 2020-04-20 |
|
1 |
|
Uniform multilevel switching of graphene oxide-based RRAM achieved by embedding with gold nanoparticles for image pattern recognition 2020-04-20 |
|
1 |
|
An investigation of aluminum nitride thin films patterned by femtosecond laser 2020-04-17 |
|
1 |
|
Stacking order driving bandgap and conductance of graphene/C3B (C3N) van der Waals heterostructures 2020-04-17 |
|
1 |
|
[(FeCoB/Ru/FeCoB)/ZnO]n superlattice multilayer: A real optical mode ferromagnetic resonance thick-film 2020-04-17 |
|
0.89 |
|
Enhancement of ferroelectric performance in PVDF:Fe3O4 nanocomposite based organic multiferroic tunnel junctions 2020-04-15 |
|
0.46 |
|
Room temperature multiferroism in BaCoF4 films prepared by pulsed laser deposition 2020-04-15 |
|
1 |
|
Strong hot-phonon bottleneck effect in all-inorganic perovskite nanocrystals 2020-04-15 |
|
1 |
|
Voltage-controlled three-state magnetic memory based on anisotropic magnetoresistance in a multiferroic heterostructure 2020-04-14 |
|
1 |
|
15.9% organic tandem solar cell with extended near-infrared absorption 2020-04-13 |
|
0.43 |
|
A ring-shaped, linear piezoelectric ultrasonic motor operating in E01 mode 2020-04-13 |
|
1 |
|
Active control of near-field radiative heat transfer through nonreciprocal graphene surface plasmons 2020-04-13 |
|
1 |
|
Demonstration and aging test of a radiation resistant strontium-90 betavoltaic mechanism 2020-04-13 |
|
1 |
|
Dielectric behavior of single iron atoms dispersed on nitrogen-doped nanocarbon 2020-04-13 |
|
1 |
|
Domain evolution in bended freestanding BaTiO3 ultrathin films: A phase-field simulation 2020-04-13 |
|
1 |
|
Domain structure formation by local switching in the ion sliced lithium niobate thin films 2020-04-13 |
|
0.17 |
|
Focus-tunable fiber-laser ultrasound sensor for high-resolution linear-scanning photoacoustic computed tomography 2020-04-13 |
|
1 |
|
MnO2-doping induced enhanced multiferroicity in Bi0.83Sm0.17Fe0.95Sc0.05O3 ceramics 2020-04-13 |
|
0.98 |
|
Surface wave photonic quasicrystal 2020-04-13 |
|
0.83 |
|
Modulation of thermal transport in AlxGa1−xAs alloy nanowires with varying compositions 2020-04-10 |
|
1 |
|
Optical properties of cubic boron arsenide 2020-04-10 |
|
0.07 |
|
Formation and magnetic-field stability of magnetic dipole skyrmions and bubbles in a ferrimagnet 2020-04-09 |
|
0.80 |
|
Giant photoinduced anomalous Hall effect of the topological surface states in three dimensional topological insulators Bi2Te3 2020-04-09 |
|
0.96 |
|
Solution-processed ITO thin-film transistors with doping of gallium oxide show high on-off ratios and work at 1 mV drain voltage 2020-04-09 |
|
1 |
|
The effect of tensor light shift on residual magnetic field compensation in a nuclear spin co-magnetometer 2020-04-09 |
|
1 |
|
Electric field thermopower modulation analyses of the operation mechanism of transparent amorphous SnO2 thin-film transistor 2020-04-07 |
|
0.13 |
|
MOCVD growth of InP-based 1.3 μm quantum dash lasers on (001) Si 2020-04-07 |
|
1 |
|
Scaling-down and interfacial effect to break down the trade-off between thermal stability and crystallization speed of the Sb2Se films 2020-04-07 |
|
1 |
|
Correlation of oxygen vacancy and Jahn–Teller polarons in epitaxial perovskite SrMnO3 ultrathin films: Dielectric spectroscopy investigations 2020-04-06 |
|
1 |
|
Deformation of Néel-type skyrmions revealed by Lorentz transmission electron microscopy 2020-04-06 |
|
0.21 |
|
Emergent ferromagnetism with tunable perpendicular magnetic anisotropy in short-periodic SrIrO3/SrRuO3 superlattices 2020-04-06 |
|
1 |
|
The de Haas-van Alphen quantum oscillations in a three-dimensional Dirac semimetal TiSb2 2020-04-06 |
|
1 |
|
The photovoltaic and photoconductive photodetector based on GeSe/2D semiconductor van der Waals heterostructure 2020-04-06 |
|
1 |
|
Thermally annealed wafer-scale h-BN films grown on sapphire substrate by molecular beam epitaxy 2020-04-06 |
|
0.94 |
|
Quantum cascade laser based, fiber coupled demultiplexed mid-infrared local oscillator for cryogenic applications 2020-04-03 |
|
1 |
|
Raman spectroscopy study of sp2 to sp3 transition in bilayer graphene under high pressures 2020-04-02 |
|
0.92 |
|
High repetition rate and high power picosecond terahertz parametric amplifier with a KTiOPO4 crystal 2020-04-01 |
|
1 |
|
Pulsed laser deposition of antimony selenosulfide thin film for efficient solar cells 2020-04-01 |
|
1 |
|
Light modulation of magnetization switching in PMN-PT/Ni heterostructure 2020-03-31 |
|
1 |
|
Liquid crystal programmable metasurface for terahertz beam steering 2020-03-31 |
|
0.86 |
|
Multi-bottle beam generation using acoustic holographic lens 2020-03-31 |
|
1 |
|
Interlayer transmission of magnons in dynamic spin valve structures 2020-03-30 |
|
0.94 |
|
Realization of a Heusler alloy Mn2FeAl with B2 ordering 2020-03-30 |
|
1 |
|
Thermally induced generation and annihilation of magnetic chiral skyrmion bubbles and achiral bubbles in Mn–Ni–Ga magnets 2020-03-30 |
|
0.65 |
|
Unraveling the transition from secondary electron emission dominated to surface charge trap dominated electronic avalanche process along the solid dielectric surface in vacuum 2020-03-30 |
|
1 |
|
Epitaxial growth of lattice-matched InSb/CdTe heterostructures on the GaAs(111) substrate by molecular beam epitaxy 2020-03-26 |
|
0.88 |
|
Shock initiation and hot spots in plastic-bonded 1,3,5-triamino-2,4,6-trinitrobenzene (TATB) 2020-03-26 |
|
0.25 |
|
Acoustic tweezers and motor for living cells 2020-03-24 |
|
1 |
|
Defects controlled doping and electrical transport in TiS2 single crystals 2020-03-24 |
|
0.94 |
|
Separative extended-gate AlGaAs/GaAs HEMT biosensors based on capacitance change strategy 2020-03-24 |
|
1 |
|
Spin pumping and laser modulated inverse spin Hall effect in yttrium iron garnet/germanium heterojunctions 2020-03-24 |
|
1 |
|
30 GHz surface acoustic wave transducers with extremely high mass sensitivity 2020-03-23 |
|
0.93 |
|
A bio-inspired functional film embedded with fluorescent elastic microspheres for pressure sensing 2020-03-23 |
|
1 |
|
A spiking neuron constructed by the skyrmion-based spin torque nano-oscillator 2020-03-23 |
|
0.86 |
|
Ferrimagnetic semiconductor with a direct bandgap 2020-03-23 |
|
1 |
|
Poling-induced inverse time-dependent microstrain mechanisms and post-poling relaxation in bismuth ferrite 2020-03-23 |
|
0.21 |
|
Preparation and study of Ce2Fe17N3 microflakes with easy-plane anisotropy and high working frequencies 2020-03-20 |
|
1 |
|
Sensitive hybrid femtosecond/picosecond vibrational coherent anti-Stokes Raman scattering thermometry using optimized probe time delays 2020-03-20 |
|
1 |
|
Decoupling of thermo-electronic effect by traveling photothermal mirror method for characterization of thermal properties of semiconductors 2020-03-19 |
|
1 |
|
Femtosecond laser modification of 6H–SiC crystals for waveguide devices 2020-03-19 |
|
1 |
|
Gradient doping of sulfur in Sb2Se3 nanowire arrays as photoelectrochemical photocathode with a 2% half-cell solar-to-hydrogen conversion efficiency 2020-03-19 |
|
1 |
|
Positive effects in perovskite solar cells achieved using down-conversion NaEuF4 nanoparticles 2020-03-19 |
|
1 |
|
Realization of “single-atom ferromagnetism” in graphene by Cu–N4 moieties anchoring 2020-03-19 |
|
0.67 |
|
Ultra-high piezoresponse in tantalum doped potassium sodium niobate single crystal 2020-03-19 |
|
0.44 |
|
Ultrathin InP annular nanohole arrays for efficient light absorption solar cells 2020-03-19 |
|
1 |
|
Palladium forms Ohmic contact on hydrogen-terminated diamond down to 4 K 2020-03-18 |
|
0.18 |
|
Avalanches and mixing behavior of porous 316L stainless steel under tension 2020-03-17 |
|
0.80 |
|
Giant photostriction of CaCu3Ti4O12 ceramics under visible light illumination 2020-03-17 |
|
1 |
|
Magnetization switching induced by magnetic field and electric current in perpendicular TbIG/Pt bilayers 2020-03-17 |
|
1 |
|
Piezoelectric biaxial strain effects on the optical and photoluminescence spectra of 2D III–VI compound α-In2Se3 nanosheets 2020-03-17 |
|
0.88 |
|
Synthesizing three-body interaction of spin chirality with superconducting qubits 2020-03-16 |
|
1 |
|
Periodical distribution of Au nanoparticles through dewetting on patterned substrates 2020-03-13 |
|
1 |
|
Statistical analysis of emission, interaction and annihilation of phonons by kink motion in ferroelastic materials 2020-03-13 |
|
0.90 |
|
In-plane crystal field constrained electronic structure of stanene 2020-03-11 |
|
1 |
|
Interface charge engineering in down-scaled AlGaN (6 nm)/GaN heterostructure for fabrication of GaN-based power HEMTs and MIS-HEMTs 2020-03-11 |
|
1 |
|
Quantitative study on the mechanisms underlying the phonon bottleneck effect in InN/InGaN multiple quantum wells 2020-03-11 |
|
1 |
|
Tunable positive magnetoresistance and crossover from weak antilocalization to weak localization transition in half-Heusler compounds RPtBi (R = lanthanide) 2020-03-11 |
|
1 |
|
A unified model for vertical doped and polarized superjunction GaN devices 2020-03-10 |
|
0.60 |
|
Bandgap widening by pressure-induced disorder in two-dimensional lead halide perovskite 2020-03-10 |
|
0.88 |
|
Effect of magnetic flux modulation on noise characteristics of tunnel magnetoresistive sensors 2020-03-10 |
|
1 |
|
Optimizing the efficiency of a periodically poled LNOI waveguide using in situ monitoring of the ferroelectric domains 2020-03-10 |
|
1 |
|
Effect of deposition temperature on ultra-low voltage resistive switching behavior of Fe-doped SrTiO3 films 2020-03-09 |
|
1 |
|
Enhanced memory characteristics of charge trapping memory by employing graphene oxide quantum dots 2020-03-09 |
|
0.94 |
|
High quality silicon: Colloidal quantum dot heterojunction based infrared photodetector 2020-03-09 |
|
1 |
|
Thermoelectric transport properties in Bi-doped SnTe–SnSe alloys 2020-03-09 |
|
1 |
|
Variation of local fields of pinned vortices with temperature 2020-03-09 |
|
0.50 |
|
Spontaneous and unidirectional transportation of underwater bubbles on superhydrophobic dual rails 2020-03-06 |
|
1 |
|
Generalized optical design of two-spherical-mirror multi-pass cells with dense multi-circle spot patterns 2020-03-04 |
|
0.60 |
|
Phase relation between supercooled liquid and amorphous silicon 2020-03-04 |
|
0.13 |
|
Determining the non-separability of vector modes with digital micromirror devices 2020-03-03 |
|
0.71 |
|
High performance hydrogen/oxygen terminated CVD single crystal diamond radiation detector 2020-03-03 |
|
1 |
|
Modulating electrical transport properties of SnSe crystal to improve the thermoelectric power factor by adjusting growth method 2020-03-03 |
|
1 |
|
Sub-bandgap optical spectroscopy of epitaxial β-Ga2O3 thin films 2020-03-03 |
|
0.25 |
|
Void-interface wetting to crossing transition owing to bubble to void transformation 2020-03-03 |
|
0.88 |
|
Magneto-transport and Shubnikov-de Haas oscillations in the layered ternary telluride topological semimetal candidate Ta3SiTe6 2020-03-02 |
|
1 |
|
Memristive devices based on 2D-BiOI nanosheets and their applications to neuromorphic computing 2020-03-02 |
|
0.95 |
|
Modifications of magnetic anisotropy of Fe3GeTe2 by the electric field effect 2020-03-02 |
|
1 |
|
The current modulation of anomalous Hall effect in van der Waals Fe3GeTe2/WTe2 heterostructures 2020-03-02 |
|
1 |
|
Hall voltage reversal and structural phase transition in VO2 thin films 2020-02-28 |
|
1 |
|
Large piezoelectricity and high transparency in fine-grained BaTiO3 ceramics 2020-02-28 |
|
1 |
|
Strong and wide microwave absorption of SrFe12−2xNixRuxO19 enhanced by dislocation stripes 2020-02-28 |
|
1 |
|
Theoretical study of the structure and magnetism of Ga1−xVxSb compounds for spintronic applications 2020-02-28 |
|
1 |
|
A high-strength Co–Fe–Ta–B metallic-glass phase enabled tensile plasticity in Co–Fe–Ta–B–O oxide glass matrix nanocomposites 2020-02-27 |
|
1 |
|
Generation of an ultra-long sub-diffracted second-harmonic optical needle from a periodically poled LiNbO3 crystal 2020-02-27 |
|
0.97 |
|
Unusual anisotropic thermal expansion in multilayer SnSe leads to positive-to-negative crossover of Poisson's ratio 2020-02-26 |
|
0.77 |
|
Energy storage oscillation of metallic glass induced by high-intensity elastic stimulation 2020-02-25 |
|
0.83 |
|
Interlayer coupling in intrinsically magnetic bilayer ScO2 and NbN2 2020-02-25 |
|
1 |
|
Strain control of phase transition and magnetocaloric effect in Nd0.5Sr0.5MnO3 thin films 2020-02-25 |
|
1 |
|
Correlation between exciton polarized lifetime and fine structure splitting in InAs/GaAs quantum dots 2020-02-24 |
|
1 |
|
Temperature-dependent nonmonotonous evolution of excitonic blue luminescence and Stokes shift in chlorine-based organometallic halide perovskite film 2020-02-21 |
|
1 |
|
Detecting current-induced quantum magnetization fluctuations with a spin-torque nano-oscillator 2020-02-20 |
|
1 |
|
Magnetostriction enhancement in ferromagnetic strain glass by approaching the crossover of martensite 2020-02-19 |
|
1 |
|
Nonreciprocal normal-incidence lateral shift for transmitted wave beams through the magnetic photonic crystal slab 2020-02-19 |
|
1 |
|
Switchable optical and acoustic resolution photoacoustic dermoscope dedicated into in vivo biopsy-like of human skin 2020-02-19 |
|
1 |
|
Systematic investigation of the growth kinetics of β-Ga2O3 epilayer by plasma enhanced chemical vapor deposition 2020-02-19 |
|
0.90 |
|
Ferromagnetic behaviors in monolayer MoS2 introduced by nitrogen-doping 2020-02-18 |
|
1 |
|
Microbubble enhanced acoustic tweezers for size-independent cell sorting 2020-02-18 |
|
0.92 |
|
Two-dimensional series connected photovoltaic cells defined by ferroelectric domains 2020-02-18 |
|
1 |
|
Mechanisms of GaN quantum dot formation during nitridation of Ga droplets 2020-02-13 |
|
0.22 |
|
Defect proliferation in CsPbBr3 crystal induced by ion migration 2020-02-12 |
|
1 |
|
Do all screw dislocations cause leakage in GaN-based devices? 2020-02-12 |
|
1 |
|
Saturable absorption properties and femtosecond mode-locking application of titanium trisulfide 2020-02-12 |
|
1 |
|
Tunable valleytronics with symmetry-retaining high polarization degree in SnSxSe1−x model system 2020-02-12 |
|
0.19 |
|
Velocity-amplified monostable dual-charged electret dome energy harvester using low-speed finger tapping 2020-02-12 |
|
1 |
|
Controlling vertical magnetization shift by spin–orbit torque in ferromagnetic/antiferromagnetic/ferromagnetic heterostructure 2020-02-11 |
|
1 |
|
Magnetocaloric effect in Ni–Fe–Mn–Sn microwires with nano-sized γ precipitates 2020-02-11 |
|
1 |
|
Resistive switching behaviors and mechanisms of HfS2 film memory devices studied by experiments and density functional theory calculations 2020-02-11 |
|
1 |
|
A dual-effect solution for broadband piezoelectric energy harvesting 2020-02-10 |
|
1 |
|
Anomalous magnetorheological effect in unstructured magnetoisotropic magnetoactive elastomers 2020-02-10 |
|
0.36 |
|
Electrical characterization of GaN Schottky barrier diode at cryogenic temperatures 2020-02-10 |
|
1 |
|
Energy-tunable photon-enhanced thermal tunneling electrons for intrinsic adaptive full spectrum solar energy conversion 2020-02-10 |
|
1 |
|
Epitaxial growth of single tellurium atomic wires on a Cu2Sb surface alloy 2020-02-10 |
|
1 |
|
Exploiting the advantages of the centrifugal softening effect in rotational impact energy harvesting 2020-02-10 |
|
1 |
|
In-plane quartz-enhanced photoacoustic spectroscopy 2020-02-10 |
|
0.71 |
|
A unified mid-gap defect model for amorphous GeTe phase change material 2020-02-05 |
|
0.50 |
|
Lateral p-GaN/2DEG junction diodes by selective-area p-GaN trench-filling-regrowth in AlGaN/GaN 2020-02-05 |
|
0.11 |
|
Enhanced magnetostriction of Tb–Dy–Fe via simultaneous ⟨111⟩-crystallographic orientation and -morphological alignment induced by directional solidification in high magnetic fields 2020-02-04 |
|
1 |
|
Helical-chiroptical nanowires generated orbital angular momentum for the detection of circularly polarized light 2020-02-04 |
|
0.92 |
|
Intense green elastico-mechanoluminescence from KZn(PO3)3:Tb3+ 2020-02-04 |
|
1 |
|
Interfacial Dzyaloshinskii-Moriya interaction between ferromagnetic insulator and heavy metal 2020-02-04 |
|
1 |
|
Rotational electromagnetic energy harvester for human motion application at low frequency 2020-02-04 |
|
1 |
|
Smart optically induced nonlinear photonic crystals for frequency conversion and control 2020-02-04 |
|
0.29 |
|
Spin-glass behavior in Co-based antiperovskite compound SnNCo3 2020-02-04 |
|
1 |
|
Suppression of magnetoelectric effects in DyCrO4 by chemical doping 2020-02-04 |
|
1 |
|
Switching of the magnetic anisotropy via strain in two dimensional multiferroic materials: CrSX (X = Cl, Br, I) 2020-02-04 |
|
0.86 |
|
Ultra-compact visible light depolarizer based on dielectric metasurface 2020-02-04 |
|
0.38 |
|
Vertically aligned nanostructure control and tunable low-field magnetoresistance in La0.5Ca0.5MnO3 single-phase thin films manipulated by a high magnetic field 2020-02-04 |
|
1 |
|
Visualizing curing process inside polymers 2020-02-04 |
|
1 |
|
Correlation transports at p-/n-types in electron metastable perovskite family of rare-earth nickelates 2020-02-03 |
|
1 |
|
Electric-field-induced phase transition in 2D layered perovskite (BA)2PbI4 microplate crystals 2020-02-03 |
|
1 |
|
Self-ejections of multiple isolated slushes on disorderly grooved superhydrophobic surfaces 2020-02-03 |
|
1 |
|
Electron and phonon transport anisotropy of ZnO at and above room temperature 2020-01-30 |
|
1 |
|
Redesign high-performance flexible thermoelectrics: From mathematical algorithm to artificial cracks 2020-01-30 |
|
1 |
|
Enhanced hybrid improper ferroelectricity in Sr3−xBaxSn2O7 ceramics with a Ruddlesden–Popper (R–P) structure 2020-01-29 |
|
1 |
|
Self-powered flexible and transparent smart patch for temperature sensing 2020-01-29 |
|
1 |
|
The relation between the collective motility and shapes of human cancer cells under heat stress 2020-01-29 |
|
1 |
|
Achieving high-resolution of 21 nm for STED nanoscopy assisted by CdSe@ZnS quantum dots 2020-01-27 |
|
1 |
|
Atomization of acoustically levitated droplet exposed to hot gases 2020-01-27 |
|
0.71 |
|
Enhancement of thermoelectric efficiency in granular Co-Cu thin films from spin-dependent scattering 2020-01-27 |
|
1 |
|
Non-contact localized probing of ferroelectric phase transitions in Li+/Er3+:BaTiO3 ceramics using fluorescence abnormalities 2020-01-27 |
|
0.88 |
|
Substrate-modulated ferromagnetism of two-dimensional Fe3GeTe2 2020-01-27 |
|
1 |
|
Toward attosecond control of electron dynamics in two-dimensional materials 2020-01-27 |
|
1 |
|
Detection of phase distribution of vortex beams based on low frequency heterodyne interferometry with a common commercial CCD camera 2020-01-23 |
|
1 |
|
Two-dimensional concentration of microparticles using bulk acousto-microfluidics 2020-01-23 |
|
1 |
|
High operating temperature InAsSb-based mid-infrared focal plane array with a band-aligned compound barrier 2020-01-22 |
|
1 |
|
Reversible H-T′ phase transition in monolayer molybdenum disulfide via electron beam assisted solid state lithiation/delithiation 2020-01-22 |
|
1 |
|
Write voltage-dependent transport mechanisms in Pt/BaTiO3/Nb:SrTiO3 ferroelectric tunnel memristors 2020-01-22 |
|
1 |
|
Memristive phase switching in two-dimensional 1T′-VSe2 crystals 2020-01-21 |
|
1 |
|
Non-reciprocal acoustic transmission via space-time modulated membranes 2020-01-21 |
|
0.21 |
|
Strong charge-density-wave order of large-area 2D metallic VSe2 nanosheets discovered by temperature-dependent Raman spectra 2020-01-21 |
|
1 |
|
Three-axis atomic magnetometer for nuclear magnetic resonance gyroscopes 2020-01-21 |
|
1 |
|
Tuning to more compressible phase in TiZrHfNb high entropy alloy by pressure 2020-01-21 |
|
0.83 |
|
Enhancement of perpendicular magnetic anisotropy of ferromagnet/oxide heterointerface by an oxygen-dependent orbital modulation 2020-01-16 |
|
1 |
|
Giant exchange bias effect in all-3d-metal Ni38.8Co2.9Mn37.9Ti20.4 thin film 2020-01-16 |
|
1 |
|
Influence of van der Waals epitaxy on phase transformation behaviors in 2D heterostructure 2020-01-16 |
|
1 |
|
Intrinsic piezoelectricity of monolayer group IV–V MX2: SiP2, SiAs2, GeP2, and GeAs2 2020-01-16 |
|
1 |
|
Oxygen octahedral tilt ordering in (Na1/2Bi1/2)TiO3 ferroelectric thin films 2020-01-16 |
|
0.54 |
|
A highly efficient method to fabricate normally-off AlGaN/GaN HEMTs with low gate leakage via Mg diffusion 2020-01-14 |
|
1 |
|
A low temperature functioning CoFeB/MgO-based perpendicular magnetic tunnel junction for cryogenic nonvolatile random access memory 2020-01-14 |
|
0.71 |
|
Bionic torus as a self-adaptive soft grasper in robots 2020-01-14 |
|
1 |
|
Decoration by dual-phase Li2ZrO3 islands with core–shell structures enhances the electrochemical performance of high-voltage LiNi0.5Mn1.5O4 2020-01-14 |
|
1 |
|
Multiple phase transitions in Sc doped Sb2Te3 amorphous nanocomposites under high pressure 2020-01-14 |
|
0.67 |
|
Three-dimensional anti-chiral auxetic metamaterial with tunable phononic bandgap 2020-01-14 |
|
1 |
|
Dynamics of an elliptical ferromagnetic skyrmion driven by the spin–orbit torque 2020-01-13 |
|
0.67 |
|
Giant elastocaloric effect in a Mn-rich Ni44Mn46Sn10 directionally solidified alloy 2020-01-13 |
|
0.82 |
|
High tunnel magnetoresistance based on 2D Dirac spin gapless semiconductor VCl3 2020-01-13 |
|
1 |
|
High-performance flexible organic thin-film transistor nonvolatile memory based on molecular floating-gate and pn-heterojunction channel layer 2020-01-13 |
|
1 |
|
Remarkably enhanced hybrid piezo/triboelectric nanogenerator via rational modulation of piezoelectric and dielectric properties for self-powered electronics 2020-01-13 |
|
0.90 |
|
Strain-engineered room temperature cavity polariton in ZnO whispering gallery microcavity 2020-01-13 |
|
1 |
|
Theoretical model of spintronic device based on tunable anomalous Hall conductivity of monolayer CrI 3 2020-01-13 |
|
1 |
|
Long-range coupling interaction between a non-magnetic transition metal capping layer and a neighboring magnetic layer 2020-01-08 |
|
1 |
|
Thermoacoustic endoscopy 2020-01-07 |
|
1 |
|
Ultra-high sensitive trace gas detection based on light-induced thermoelastic spectroscopy and a custom quartz tuning fork 2020-01-07 |
|
0.58 |
|
Characteristic investigation of highly oriented Hf0.5Zr0.5O2 thin-film resistive memory devices 2020-01-06 |
|
0.58 |
|
Charge transfer dynamics of the CdTe quantum dots fluorescence quenching induced by ferrous (II) ions 2020-01-06 |
|
1 |
|
Role of finite-size effect in BiFeO3 nanoparticles to enhance ferromagnetism and microwave absorption 2020-01-03 |
|
1 |
|
Shannon entropy and quantitative time irreversibility for different and even contradictory aspects of complex systems 2020-01-03 |
|
1 |
|
Temperature profile and transient response of thermally tunable ridge waveguides with laterally supported suspension 2020-01-03 |
|
0.39 |
|
Artificial synaptic transistor with solution processed InOx channel and AlOx solid electrolyte gate 2020-01-02 |
|
1 |
|
Broadband modulation of subwavelength topological interface states in a one-dimensional acoustic system 2020-01-02 |
|
1 |
|
High temperature (300 °C) ALD grown Al2O3 on hydrogen terminated diamond: Band offset and electrical properties of the MOSFETs 2020-01-02 |
|
1 |
|
Orientation-selective elliptic optical vortex array 2020-01-02 |
|
1 |
|
Web buckle-mediated room-temperature ferromagnetism in strained MoS2 thin films 2020-01-02 |
|
1 |
|
Single-layer LaBr2: Two-dimensional valleytronic semiconductor with spontaneous spin and valley polarizations 2019-12-31 |
|
1 |
|
Mott insulator to metal transition driven by oxygen incorporation in epitaxial LaTiO3 films 2019-12-30 |
|
0.88 |
|
From symmetry to entropy: Crystal entropy difference strongly affects early stage phase transformation 2019-12-27 |
|
0.56 |
|
Magnetically modulated orbit for human motion energy harvesting 2019-12-27 |
|
1 |
|
Graphene-based thermal repeater 2019-12-26 |
|
0.80 |
|
High efficiency, high color rendering index white organic light-emitting diodes based on thermally activated delayed fluorescence materials 2019-12-26 |
|
1 |
|
In-situ stress modulated ferroelectric photovoltaic effect in cluster-assembled TbFe2/Bi5Ti3FeO15 heterostructural films 2019-12-26 |
|
1 |
|
Nonlinear optical effect of interlayer charge transfer in a van der Waals heterostructure 2019-12-26 |
|
0.50 |
|
Properties of self-mixing interference in terahertz distributed feedback quantum cascade lasers 2019-12-26 |
|
1 |
|
Quantum paraelectricity to dipolar glass transition in Sc doped BaFe12O19 single crystals 2019-12-26 |
|
1 |
|
Thickness-dependent ultrafast nonlinear absorption properties of PtSe2 films with both semiconducting and semimetallic phases 2019-12-26 |
|
1 |
|
A method for analyzing two-dimensional lithium ion concentration in the nano silicon films 2019-12-23 |
|
1 |
|
Dynamic study of phase transition in Bi2O3 epitaxial film induced by electrolyte gating 2019-12-23 |
|
1 |
|
Room-temperature ferromagnetism in C+ -implanted AlN films 2019-12-23 |
|
1 |
|
Demonstration of low loss β-Ga2O3 optical waveguides in the UV–NIR spectra 2019-12-18 |
|
0.15 |
|
Hydrogen gas ppb-level detection based on AlGaN/GaN high electron mobility transistor with 2.0 nm thick Pt gate layer 2019-12-18 |
|
1 |
|
Modulation of THz radiation via enhanced Dirac plasmon-dual phonon interaction 2019-12-18 |
|
1 |
|
Non-linear behavior of flexoelectricity 2019-12-18 |
|
1 |
|
Strain engineering on the metal-insulator transition of VO2/TiO2 epitaxial films dependent on the strain state of vanadium dimers 2019-12-18 |
|
1 |
|
γ-GeSe: A two-dimensional ferroelectric material with doping-induced ferromagnetism 2019-12-18 |
|
1 |
|
Large magnetoelectric effect in the polar magnet Sm2BaCuO5 2019-12-17 |
|
1 |
|
Thermally controlled topological states for elastic waves 2019-12-17 |
|
1 |
|
Twin-beam-enhanced displacement measurement of a membrane in a cavity 2019-12-17 |
|
1 |
|
Ultrasensitive detection of ion concentration based on photonic spin Hall effect 2019-12-17 |
|
1 |
|
A vibration energy harvester based on Ca3TaGa3Si2O14 piezoelectric crystal for high temperature applications 2019-12-16 |
|
1 |
|
High transmittance Er-doped ZnO thin films as electrodes for organic light-emitting diodes 2019-12-16 |
|
1 |
|
Direct imaging of carrier diffusion length in organic-inorganic perovskites 2019-12-12 |
|
1 |
|
A universal method to fabricate p-n or Schottky heterojunctions based on two-dimensional electron gas 2019-12-11 |
|
1 |
|
Biodegradable transient resistive random-access memory based on MoO3/MgO/MoO3 stack 2019-12-10 |
|
1 |
|
Carrier accumulation enhanced Auger recombination and inner self-heating-induced spectrum fluctuation in CsPbBr3 perovskite nanocrystal light-emitting devices 2019-12-10 |
|
1 |
|
Flexible ultrahigh energy storage density in lead-free heterostructure thin-film capacitors 2019-12-10 |
|
1 |
|
Probing the origins of electroresistance switching behavior in ferroelectric thin films 2019-12-10 |
|
1 |
|
Winner-takes-all mechanism realized by memristive neural network 2019-12-10 |
|
0.75 |
|
A black phosphorus nanoconveyor belt system 2019-12-09 |
|
1 |
|
Coherent exciton-phonon coupling in perovskite semiconductor nanocrystals studied by two-dimensional electronic spectroscopy 2019-12-09 |
|
0.92 |
|
Electric field measurements under DC corona discharges in ambient air by electric field induced second harmonic generation 2019-12-09 |
|
1 |
|
Gradual resistive switching: Insights from inverse nonexponential decay and unified theoretical modeling 2019-12-09 |
|
0.50 |
|
Janus PtSSe and graphene heterostructure with tunable Schottky barrier 2019-12-09 |
|
0.13 |
|
Magnetoelastic anisotropy of antiferromagnetic materials 2019-12-09 |
|
1 |
|
Recovery of cycling-induced endurance failed HfOx based memristive devices by utilizing oxygen plasma treatment 2019-12-09 |
|
1 |
|
Measurement of multiple physical parameters of dense gaseous hydrogen-deuterium mixture under double-shock compression: Evaluating theoretical models from multiple views 2019-12-05 |
|
1 |
|
Abnormal physical behaviors of hafnium diboride under high pressure 2019-12-04 |
|
0.94 |
|
Acoustic tunable metamaterials based on anisotropic unit cells 2019-12-04 |
|
1 |
|
Spin-wave frequency division multiplexing in an yttrium iron garnet microstripe magnetized by inhomogeneous field 2019-12-04 |
|
0.13 |
|
Large bandgap tunability of GaN/ZnO pseudobinary alloys through combined engineering of anions and cations 2019-12-03 |
|
1 |
|
Interface reaction kinetics in SiGe oxidation 2019-12-02 |
|
0.13 |
|
Self-formed PbI2-DMSO adduct for highly efficient and stable perovskite solar cells 2019-12-02 |
|
1 |
|
Single-shot curvature sensing with non-coaxial Fibonacci-sieve filter in telescope 2019-12-02 |
|
1 |
|
Spatial distribution of the phononic crystal modes excited by a moving laser source 2019-12-02 |
|
0.92 |
|
Generation and manipulation of chiral broadband terahertz waves from cascade spintronic terahertz emitters 2019-11-27 |
|
1 |
|
Light-controlled flexible tunable grating-based absorption spectroscopy for gas detection 2019-11-27 |
|
1 |
|
Cassegrain metasurface for generation of orbital angular momentum of light 2019-11-26 |
|
1 |
|
Controllable growth of P-type graphene on the boron ion-implanted Si-face of SiC (0001) 2019-11-26 |
|
1 |
|
Directly extracting the authentic basis of cylindrical vector beams by a pump-probe technique in an atomic vapor 2019-11-26 |
|
0.92 |
|
Experimental study of protein translocation through MoS2 nanopores 2019-11-26 |
|
1 |
|
High-performance all-solution-processed quantum dot near-infrared-to-visible upconversion devices for harvesting photogenerated electrons 2019-11-26 |
|
0.94 |
|
One-step solution deposited all-inorganic perovskite CsPbBr3 film for flexible resistive switching memories 2019-11-26 |
|
1 |
|
Achieve single domain state in (111)-oriented rhombohedral phase PMN-PT relaxor ferroelectric single crystals for electro-optical application 2019-11-25 |
|
0.92 |
|
Anisotropic electronic structure of antimonene 2019-11-25 |
|
1 |
|
Dielectric properties and electrocaloric effect of high-entropy (Na0.2Bi0.2Ba0.2Sr0.2Ca0.2)TiO3 ceramic 2019-11-25 |
|
1 |
|
Generation and detection of coherent longitudinal acoustic waves in ultrathin 1T’-MoTe2 2019-11-25 |
|
0.25 |
|
Magnetic and transport properties of a ferromagnetic layered semiconductor MnIn2Se4 2019-11-25 |
|
0.93 |
|
Temperature- and pulse-dependent negative differential resistances in ZnO/Nb:SrTiO3 heterojunctions 2019-11-25 |
|
1 |
|
On the anisotropies of magnetization and electronic transport of magnetic Weyl semimetal Co3Sn2S2 2019-11-22 |
|
1 |
|
Band structure tailoring in ZrSe2 single crystal via trace rhenium intercalation 2019-11-20 |
|
0.96 |
|
Cobalt doping of bismuth ferrite for matched dielectric and magnetic loss 2019-11-20 |
|
1 |
|
Photocurrents in GaN-based HEMTs: Theoretical model and experimental results 2019-11-20 |
|
1 |
|
Demonstration of a 6 state-4 state reference frame independent channel for quantum key distribution 2019-11-19 |
|
0.06 |
|
Enhance stable coupling region of a high-Q WGM up to micrometer 2019-11-19 |
|
1 |
|
Observation of large anomalous Nernst effect in 2D layered materials Fe3GeTe2 2019-11-19 |
|
1 |
|
Silicon photoanodes partially covered by Ni@Fe core-shell particles with in situ formed gradient-enhanced junction electric field for photoelectrochemical water oxidation 2019-11-19 |
|
1 |
|
Analysis of the magnetic properties of a silicate-coated spherical FeSiAl-based soft magnetic composite for high-frequency power-applications 2019-11-18 |
|
1 |
|
Energy storage properties of polyimide/BaTiO3 nanocomposite films and their breakdown mechanism in a wide content range 2019-11-18 |
|
0.73 |
|
In situ surface modification of TiO2 by CaTiO3 to improve the UV stability and power conversion efficiency of perovskite solar cells 2019-11-18 |
|
0.94 |
|
Nonlinear frequency conversion of vector beams with four wave mixing in atomic vapor 2019-11-18 |
|
1 |
|
Self-cleaning organic solar cells based on micro/nanostructured haze films with optical enhancement effect 2019-11-18 |
|
1 |
|
Anharmonicity of Bi2Se3 revealed by fs transient optical spectroscopy 2019-11-15 |
|
1 |
|
Multi-wave mixing using a single vector optical field 2019-11-14 |
|
1 |
|
Tuning electrical properties and phase transitions through strain engineering in lead-free ferroelectric K0.5Na0.5NbO3-LiTaO3-CaZrO3 thin films 2019-11-14 |
|
1 |
|
A string-driven rotor for efficient energy harvesting from ultra-low frequency excitations 2019-11-13 |
|
0.80 |
|
Strain-driven lattice distortion and the resultant magnetic properties of La0.7Sr0.3MnO3/BaTiO3 superlattices 2019-11-12 |
|
1 |
|
Tunable high-quality Fano resonance in coupled terahertz whispering-gallery-mode resonators 2019-11-12 |
|
1 |
|
Ultrafast ultrasound imaging in acoustic microbubble trapping 2019-11-12 |
|
0.22 |
|
Unusual electric field-induced optical behaviors in cesium lead bromide perovskites 2019-11-12 |
|
0.80 |
|
Band alignment and band bending at α-Ga2O3/ZnO n-n isotype hetero-interface 2019-11-11 |
|
0.71 |
|
In-situ control of electrical properties of nanoelectromechanical resonators by electromigration for self-sustained oscillations 2019-11-11 |
|
0.89 |
|
Tunable giant Rashba-type spin splitting in PtSe2/MoSe2 heterostructure 2019-11-11 |
|
1 |
|
Tuning critical phase transition in VO2 via interfacial control of normal and shear strain 2019-11-11 |
|
0.89 |
|
Ultralow thermal conductivity and high thermoelectric performance of Cu2Se/TiO2 nanocomposite 2019-11-11 |
|
1 |
|
Pressure-enhanced electronic coupling of highly passivated quantum dot films to improve photovoltaic performance 2019-11-07 |
|
0.88 |
|
A double-beam piezo-magneto-elastic wind energy harvester for improving the galloping-based energy harvesting 2019-11-06 |
|
0.67 |
|
A robust actively-tunable perfect sound absorber 2019-11-06 |
|
1 |
|
Effect of vacancies on thermoelectric properties of β-CuAgSe studied by positron annihilation 2019-11-06 |
|
1 |
|
Perovskite light-emitting diodes for uniform eight-segment displays 2019-11-06 |
|
0.94 |
|
Physical reservoir computing using magnetic skyrmion memristor and spin torque nano-oscillator 2019-11-06 |
|
1 |
|
The effect of phase purification on photovoltaic performance of perovskite solar cells 2019-11-06 |
|
1 |
|
A passive AC/DC current sensing methodology for diverse multiline cables 2019-11-05 |
|
0.50 |
|
Hetero-integration of quasi two-dimensional PbZr0.2Ti0.8O3 on AlGaN/GaN HEMT and non-volatile modulation of two-dimensional electron gas 2019-11-05 |
|
1 |
|
Thermal transport and energy dissipation in two-dimensional Bi2O2Se 2019-11-05 |
|
0.80 |
|
A mechanical wave switch with tunable frequency output 2019-11-04 |
|
1 |
|
High frequency H-diamond MISFET with output power density of 182 mW/mm at 10 GHz 2019-11-04 |
|
1 |
|
High on/off ratio black phosphorus based memristor with ultra-thin phosphorus oxide layer 2019-11-04 |
|
0.80 |
|
Nonlinear terahertz emission in the three-dimensional topological insulator Bi2Te3 by terahertz emission spectroscopy 2019-11-04 |
|
0.92 |
|
Uniform atmospheric pressure plasmas in a 7 mm air gap 2019-11-04 |
|
0.48 |
